C20H22N4O4S2 — CID 46404327
2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-methyl-N-[(3-nitrophenyl)methyl]propanamide (PubChem CID 46404327) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-methyl-N-[(3-nitrophenyl)methyl]propanamide.
| Compound Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-methyl-N-[(3-nitrophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 46404327 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | 2-[(5,6-dimethyl-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl)methylsulfanyl]-N-methyl-N-[(3-nitrophenyl)methyl]propanamide |
| SMILES | Cc1sc2nc(CSC(C)C(=O)N(C)Cc3cccc([N+](=O)[O-])c3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C20H22N4O4S2/c1-11-12(2)30-19-17(11)18(25)21-16(22-19)10-29-13(3)20(26)23(4)9-14-6-5-7-15(8-14)24(27)28/h5-8,13H,9-10H2,1-4H3,(H,21,22,25) |
| InChIKey | YMDQUGHBCIOJFK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|