C20H20N4O4S2 — CID 55483515
5,6-dimethyl-2-[[1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 55483515) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 5,6-dimethyl-2-[[1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5,6-dimethyl-2-[[1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 55483515 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | 5,6-dimethyl-2-[[1-(6-nitro-2,3-dihydroindol-1-yl)-1-oxopropan-2-yl]sulfanylmethyl]-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(CSC(C)C(=O)N3CCc4ccc([N+](=O)[O-])cc43)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C20H20N4O4S2/c1-10-11(2)30-19-17(10)18(25)21-16(22-19)9-29-12(3)20(26)23-7-6-13-4-5-14(24(27)28)8-15(13)23/h4-5,8,12H,6-7,9H2,1-3H3,(H,21,22,25) |
| InChIKey | AZEBPTGKTBWZRG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 109.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|