About 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1)
2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) (PubChem CID 46406) has the molecular formula C11H18ClNO
and a molecular weight of 215.72 g/mol. Its IUPAC name is (1-hydroxy-1-phenylpentan-2-yl)azanium chloride.
Molecular Properties
| Compound Name | 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) |
| PubChem CID | 46406 |
| Molecular Formula | C11H18ClNO |
| Molecular Weight | 215.72 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1-hydroxy-1-phenylpentan-2-yl)azanium chloride |
| SMILES | CCCC(C(C1=CC=CC=C1)O)[NH3+].[Cl-] |
| InChI | InChI=1S/C11H17NO.ClH/c1-2-6-10(12)11(13)9-7-4-3-5-8-9;/h3-5,7-8,10-11,13H,2,6,12H2,1H3;1H |
| InChIKey | IIOOMPVSYKQIRA-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 47.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | 132 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1)?
The IUPAC name of 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) (CID 46406) is (1-hydroxy-1-phenylpentan-2-yl)azanium chloride.
What is the SMILES notation for 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1)?
The canonical SMILES for 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) is CCCC(C(C1=CC=CC=C1)O)[NH3+].[Cl-].
What is the InChIKey of 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1)?
The InChIKey is IIOOMPVSYKQIRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO.ClH/c1-2-6-10(12)11(13)9-7-4-3-5-8-9;/h3-5,7-8,10-11,13H,2,6,12H2,1H3;1H.
What are the key properties of 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1)?
2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) has a molecular weight of 215.72 g/mol, XLogP of not available, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Amino-1-phenylpentan-1-ol--hydrogen chloride (1/1) is sourced from PubChem (CID 46406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).