C16H21Cl2FN2O2 — CID 4640618
N-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 4640618) has the molecular formula C16H21Cl2FN2O2 and a molecular weight of 363.26 g/mol. Its IUPAC name is N-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | N-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 4640618 |
| Molecular Formula | C16H21Cl2FN2O2 |
| Molecular Weight | 363.26 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | Cc1ccc(C(NC(=O)N2CC(C)OC(C)C2)C(Cl)Cl)cc1F |
| InChI | InChI=1S/C16H21Cl2FN2O2/c1-9-4-5-12(6-13(9)19)14(15(17)18)20-16(22)21-7-10(2)23-11(3)8-21/h4-6,10-11,14-15H,7-8H2,1-3H3,(H,20,22) |
| InChIKey | HVZZCOGLJCDBBM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|