C16H22Cl2FN3O — CID 2331449
N-[(1S)-2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-4-ethylpiperazine-1-carboxamide (PubChem CID 2331449) has the molecular formula C16H22Cl2FN3O and a molecular weight of 362.28 g/mol. Its IUPAC name is N-[(1S)-2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-4-ethylpiperazine-1-carboxamide.
| Compound Name | N-[(1S)-2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-4-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 2331449 |
| Molecular Formula | C16H22Cl2FN3O |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | N-[(1S)-2,2-dichloro-1-(3-fluoro-4-methylphenyl)ethyl]-4-ethylpiperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)N[C@@H](c2ccc(C)c(F)c2)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C16H22Cl2FN3O/c1-3-21-6-8-22(9-7-21)16(23)20-14(15(17)18)12-5-4-11(2)13(19)10-12/h4-5,10,14-15H,3,6-9H2,1-2H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | CVWIZYDBBSYGBZ-AWEZNQCLSA-N |
| XLogP | 3.33 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|