C16H24FN3O2 — CID 95968299
4-ethyl-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperazine-1-carboxamide (PubChem CID 95968299) has the molecular formula C16H24FN3O2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 4-ethyl-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperazine-1-carboxamide.
| Compound Name | 4-ethyl-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 95968299 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 4-ethyl-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)N[C@@H](C)c2c(F)cccc2OC)CC1 |
| InChI | InChI=1S/C16H24FN3O2/c1-4-19-8-10-20(11-9-19)16(21)18-12(2)15-13(17)6-5-7-14(15)22-3/h5-7,12H,4,8-11H2,1-3H3,(H,18,21)/t12-/m0/s1 |
| InChIKey | ZVJJTBHWAGVITJ-LBPRGKRZSA-N |
| XLogP | 2.24 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |