C17H26FN3O2 — CID 96565751
(3R)-3-(dimethylamino)-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperidine-1-carboxamide (PubChem CID 96565751) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is (3R)-3-(dimethylamino)-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperidine-1-carboxamide.
| Compound Name | (3R)-3-(dimethylamino)-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 96565751 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3R)-3-(dimethylamino)-N-[(1S)-1-(2-fluoro-6-methoxyphenyl)ethyl]piperidine-1-carboxamide |
| SMILES | COc1cccc(F)c1[C@H](C)NC(=O)N1CCC[C@@H](N(C)C)C1 |
| InChI | InChI=1S/C17H26FN3O2/c1-12(16-14(18)8-5-9-15(16)23-4)19-17(22)21-10-6-7-13(11-21)20(2)3/h5,8-9,12-13H,6-7,10-11H2,1-4H3,(H,19,22)/t12-,13+/m0/s1 |
| InChIKey | USVSUEOJGWGVLV-QWHCGFSZSA-N |
| XLogP | 2.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |