C20H22N4O3S2 — CID 46411605
4-(diethylsulfamoyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide (PubChem CID 46411605) has the molecular formula C20H22N4O3S2 and a molecular weight of 430.56 g/mol. Its IUPAC name is 4-(diethylsulfamoyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide.
| Compound Name | 4-(diethylsulfamoyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46411605 |
| Molecular Formula | C20H22N4O3S2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 4-(diethylsulfamoyl)-N-[3-(2-sulfanylidene-1H-imidazol-3-yl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2cccc(-n3cc[nH]c3=S)c2)cc1 |
| InChI | InChI=1S/C20H22N4O3S2/c1-3-23(4-2)29(26,27)18-10-8-15(9-11-18)19(25)22-16-6-5-7-17(14-16)24-13-12-21-20(24)28/h5-14H,3-4H2,1-2H3,(H,21,28)(H,22,25) |
| InChIKey | RNCKBEFRJGSQIH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|