C21H21N3O3 — CID 46412931
4-(1H-indol-3-yl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]butanamide (PubChem CID 46412931) has the molecular formula C21H21N3O3 and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-(1H-indol-3-yl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]butanamide.
| Compound Name | 4-(1H-indol-3-yl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 46412931 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-(1H-indol-3-yl)-N-[3-(2-oxo-1,3-oxazolidin-3-yl)phenyl]butanamide |
| SMILES | O=C(CCCc1c[nH]c2ccccc12)Nc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C21H21N3O3/c25-20(10-3-5-15-14-22-19-9-2-1-8-18(15)19)23-16-6-4-7-17(13-16)24-11-12-27-21(24)26/h1-2,4,6-9,13-14,22H,3,5,10-12H2,(H,23,25) |
| InChIKey | UHOJWJZHEBCXLR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |