C18H19N3O4S — CID 55610306
N-[4-oxo-4-[3-(2-oxo-1,3-oxazolidin-3-yl)anilino]butyl]thiophene-2-carboxamide (PubChem CID 55610306) has the molecular formula C18H19N3O4S and a molecular weight of 373.43 g/mol. Its IUPAC name is N-[4-oxo-4-[3-(2-oxo-1,3-oxazolidin-3-yl)anilino]butyl]thiophene-2-carboxamide.
| Compound Name | N-[4-oxo-4-[3-(2-oxo-1,3-oxazolidin-3-yl)anilino]butyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55610306 |
| Molecular Formula | C18H19N3O4S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | N-[4-oxo-4-[3-(2-oxo-1,3-oxazolidin-3-yl)anilino]butyl]thiophene-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1cccs1)Nc1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C18H19N3O4S/c22-16(7-2-8-19-17(23)15-6-3-11-26-15)20-13-4-1-5-14(12-13)21-9-10-25-18(21)24/h1,3-6,11-12H,2,7-10H2,(H,19,23)(H,20,22) |
| InChIKey | KAUDXWYSTQFOLS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|