C19H17FN4O3 — CID 46413058
1-(4-fluorophenyl)-N,5-dimethyl-N-[(2-nitrophenyl)methyl]pyrazole-4-carboxamide (PubChem CID 46413058) has the molecular formula C19H17FN4O3 and a molecular weight of 368.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2-nitrophenyl)methyl]pyrazole-4-carboxamide.
| Compound Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2-nitrophenyl)methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46413058 |
| Molecular Formula | C19H17FN4O3 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-(4-fluorophenyl)-N,5-dimethyl-N-[(2-nitrophenyl)methyl]pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)Cc2ccccc2[N+](=O)[O-])cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN4O3/c1-13-17(11-21-23(13)16-9-7-15(20)8-10-16)19(25)22(2)12-14-5-3-4-6-18(14)24(26)27/h3-11H,12H2,1-2H3 |
| InChIKey | YKSQLPRLSDMZEH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|