C18H17N5O3 — CID 46399431
N,5-dimethyl-N-[(2-nitrophenyl)methyl]-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 46399431) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is N,5-dimethyl-N-[(2-nitrophenyl)methyl]-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N,5-dimethyl-N-[(2-nitrophenyl)methyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 46399431 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N,5-dimethyl-N-[(2-nitrophenyl)methyl]-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)Cc2ccccc2[N+](=O)[O-])cnn1-c1ccccn1 |
| InChI | InChI=1S/C18H17N5O3/c1-13-15(11-20-22(13)17-9-5-6-10-19-17)18(24)21(2)12-14-7-3-4-8-16(14)23(25)26/h3-11H,12H2,1-2H3 |
| InChIKey | OQQLIFQCNJMQEH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|