C21H29N5O — CID 157013558
N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxamide (PubChem CID 157013558) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 157013558 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-[(3aS,6aR)-5-(dimethylamino)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-N,5-dimethyl-1-pyridin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C2C[C@H]3CC(N(C)C)C[C@H]3C2)cnn1-c1ccccn1 |
| InChI | InChI=1S/C21H29N5O/c1-14-19(13-23-26(14)20-7-5-6-8-22-20)21(27)25(4)18-11-15-9-17(24(2)3)10-16(15)12-18/h5-8,13,15-18H,9-12H2,1-4H3/t15-,16+,17?,18? |
| InChIKey | ZJQDJNFWRPDQHY-OQSMONGASA-N |
| XLogP | 2.77 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |