C25H33N5OS — CID 46413877
N-[2-(diethylamino)-3-phenylpropyl]-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide (PubChem CID 46413877) has the molecular formula C25H33N5OS and a molecular weight of 451.64 g/mol. Its IUPAC name is N-[2-(diethylamino)-3-phenylpropyl]-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide.
| Compound Name | N-[2-(diethylamino)-3-phenylpropyl]-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
|---|---|
| PubChem CID | 46413877 |
| Molecular Formula | C25H33N5OS |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-[2-(diethylamino)-3-phenylpropyl]-3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanamide |
| SMILES | CCN(CC)C(CNC(=O)CCn1c(-c2cccc(C)c2)n[nH]c1=S)Cc1ccccc1 |
| InChI | InChI=1S/C25H33N5OS/c1-4-29(5-2)22(17-20-11-7-6-8-12-20)18-26-23(31)14-15-30-24(27-28-25(30)32)21-13-9-10-19(3)16-21/h6-13,16,22H,4-5,14-15,17-18H2,1-3H3,(H,26,31)(H,28,32) |
| InChIKey | LKYFNLZTYWUCLU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|