C14H19BrN2O2S — CID 46418106
3-(2-amino-2-oxoethyl)sulfanyl-N-[1-(4-bromophenyl)propyl]propanamide (PubChem CID 46418106) has the molecular formula C14H19BrN2O2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-(4-bromophenyl)propyl]propanamide.
| Compound Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-(4-bromophenyl)propyl]propanamide |
|---|---|
| PubChem CID | 46418106 |
| Molecular Formula | C14H19BrN2O2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)sulfanyl-N-[1-(4-bromophenyl)propyl]propanamide |
| SMILES | CCC(NC(=O)CCSCC(N)=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrN2O2S/c1-2-12(10-3-5-11(15)6-4-10)17-14(19)7-8-20-9-13(16)18/h3-6,12H,2,7-9H2,1H3,(H2,16,18)(H,17,19) |
| InChIKey | LVMGXTOJRZCPPX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|