C16H23BrN2OS2 — CID 7841284
[2-[[(1S)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 7841284) has the molecular formula C16H23BrN2OS2 and a molecular weight of 403.41 g/mol. Its IUPAC name is [2-[[(1S)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[[(1S)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 7841284 |
| Molecular Formula | C16H23BrN2OS2 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | [2-[[(1S)-1-(4-bromophenyl)propyl]amino]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CC[C@H](NC(=O)CSC(=S)N(CC)CC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN2OS2/c1-4-14(12-7-9-13(17)10-8-12)18-15(20)11-22-16(21)19(5-2)6-3/h7-10,14H,4-6,11H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | FRILEUHTQCNNCJ-AWEZNQCLSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|