C25H37N3O5 — CID 46420020
N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 46420020) has the molecular formula C25H37N3O5 and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 46420020 |
| Molecular Formula | C25H37N3O5 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)-2-methylpropyl]-2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCOc1ccc(C(NC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)C(C)C)cc1OCC |
| InChI | InChI=1S/C25H37N3O5/c1-6-32-19-9-8-18(14-20(19)33-7-2)22(16(3)4)26-21(29)15-28-23(30)25(27-24(28)31)12-10-17(5)11-13-25/h8-9,14,16-17,22H,6-7,10-13,15H2,1-5H3,(H,26,29)(H,27,31) |
| InChIKey | CWQGUNMOHBEHOF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|