spiro[2.3]hexane-2-carboxylic acid

C7H10O2 — CID 4642003

IUPACspiro[2.3]hexane-2-carboxylic acid
SMILESO=C(O)C1CC12CCC2
InChIInChI=1S/C7H10O2/c8-6(9)5-4-7(5)2-1-3-7/h5H,1-4H2,(H,8,9)
InChIKeyVVSCGNLRDCLHAN-UHFFFAOYSA-N
MW126.16 g/mol
LogP1.26
Rot. Bonds1

About spiro[2.3]hexane-2-carboxylic acid

spiro[2.3]hexane-2-carboxylic acid (PubChem CID 4642003) has the molecular formula C7H10O2 and a molecular weight of 126.16 g/mol. Its IUPAC name is spiro[2.3]hexane-2-carboxylic acid.

Molecular Properties

Compound Namespiro[2.3]hexane-2-carboxylic acid
PubChem CID4642003
Molecular FormulaC7H10O2
Molecular Weight126.16 g/mol
Exact Mass126.07
IUPAC Namespiro[2.3]hexane-2-carboxylic acid
SMILESO=C(O)C1CC12CCC2
InChIInChI=1S/C7H10O2/c8-6(9)5-4-7(5)2-1-3-7/h5H,1-4H2,(H,8,9)
InChIKeyVVSCGNLRDCLHAN-UHFFFAOYSA-N
XLogP1.26
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500126.16
LogP ≤ 51.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze spiro[2.3]hexane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Pinic acid
CID 10131
3,4-Methylene hexanedioic acid
CID 191303
3-Cyclobutylpropanoic acid
CID 13155029
3-(2,2-Dimethylcyclopropyl)propanoic acid
CID 14545624
Spiropentaneacetic acid
CID 193489
Bicyclo(3.1.0)hexane-1-carboxylic acid
CID 12523696
Bicyclo[2.2.0]hexane-1-carboxylic acid
CID 12706147
Spiro[3.3]heptane-2-carboxylic acid
CID 20320775
3-Cyclobutyl-2,2-dimethylpropanoic acid
CID 20517130
Dispiro[2.0.2^{4}.1^{3}]heptane-7-carboxylic acid
CID 55301601
2,2-Difluorospiro[2.3]hexane-1-carboxylic acid
CID 130743894
1,2-Cyclobutanediacetic acid
CID 273162

Frequently Asked Questions

What is the IUPAC name of spiro[2.3]hexane-2-carboxylic acid?
The IUPAC name of spiro[2.3]hexane-2-carboxylic acid (CID 4642003) is spiro[2.3]hexane-2-carboxylic acid.
What is the SMILES notation for spiro[2.3]hexane-2-carboxylic acid?
The canonical SMILES for spiro[2.3]hexane-2-carboxylic acid is O=C(O)C1CC12CCC2.
What is the InChIKey of spiro[2.3]hexane-2-carboxylic acid?
The InChIKey is VVSCGNLRDCLHAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2/c8-6(9)5-4-7(5)2-1-3-7/h5H,1-4H2,(H,8,9).
What are the key properties of spiro[2.3]hexane-2-carboxylic acid?
spiro[2.3]hexane-2-carboxylic acid has a molecular weight of 126.16 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2.3]hexane-2-carboxylic acid is sourced from PubChem (CID 4642003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).