C23H24F2N2O3 — CID 46424827
N-[2-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]-2-oxoethyl]-2,4-difluorobenzamide (PubChem CID 46424827) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is N-[2-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]-2-oxoethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]-2-oxoethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 46424827 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-[2-[4-(2,4-dimethylbenzoyl)piperidin-1-yl]-2-oxoethyl]-2,4-difluorobenzamide |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)CNC(=O)c3ccc(F)cc3F)CC2)c(C)c1 |
| InChI | InChI=1S/C23H24F2N2O3/c1-14-3-5-18(15(2)11-14)22(29)16-7-9-27(10-8-16)21(28)13-26-23(30)19-6-4-17(24)12-20(19)25/h3-6,11-12,16H,7-10,13H2,1-2H3,(H,26,30) |
| InChIKey | IZMGZMGSUURVIE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |