C22H19F3N2O — CID 46426235
(E)-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 46426235) has the molecular formula C22H19F3N2O and a molecular weight of 384.40 g/mol. Its IUPAC name is (E)-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 46426235 |
| Molecular Formula | C22H19F3N2O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | (E)-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CN(C)c1ccc(NC(=O)/C=C/c2cccc3ccccc23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H19F3N2O/c1-27(2)17-11-12-20(19(14-17)22(23,24)25)26-21(28)13-10-16-8-5-7-15-6-3-4-9-18(15)16/h3-14H,1-2H3,(H,26,28)/b13-10+ |
| InChIKey | SLWNBIHFMWRTPF-JLHYYAGUSA-N |
| XLogP | 5.58 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|