C21H24ClF3N2O3 — CID 46426381
3-chloro-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-5-ethoxy-4-propoxybenzamide (PubChem CID 46426381) has the molecular formula C21H24ClF3N2O3 and a molecular weight of 444.88 g/mol. Its IUPAC name is 3-chloro-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-5-ethoxy-4-propoxybenzamide.
| Compound Name | 3-chloro-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-5-ethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 46426381 |
| Molecular Formula | C21H24ClF3N2O3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 3-chloro-N-[4-(dimethylamino)-2-(trifluoromethyl)phenyl]-5-ethoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)Nc2ccc(N(C)C)cc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C21H24ClF3N2O3/c1-5-9-30-19-16(22)10-13(11-18(19)29-6-2)20(28)26-17-8-7-14(27(3)4)12-15(17)21(23,24)25/h7-8,10-12H,5-6,9H2,1-4H3,(H,26,28) |
| InChIKey | MRSYPJQZZWVOGG-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |