C14H22N4O5S — CID 46434224
N-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-nitroanilino)propanamide (PubChem CID 46434224) has the molecular formula C14H22N4O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is N-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-nitroanilino)propanamide.
| Compound Name | N-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-nitroanilino)propanamide |
|---|---|
| PubChem CID | 46434224 |
| Molecular Formula | C14H22N4O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[3-[methyl(methylsulfonyl)amino]propyl]-3-(2-nitroanilino)propanamide |
| SMILES | CN(CCCNC(=O)CCNc1ccccc1[N+](=O)[O-])S(C)(=O)=O |
| InChI | InChI=1S/C14H22N4O5S/c1-17(24(2,22)23)11-5-9-16-14(19)8-10-15-12-6-3-4-7-13(12)18(20)21/h3-4,6-7,15H,5,8-11H2,1-2H3,(H,16,19) |
| InChIKey | HYBINOQAEWRVPM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|