C19H18FN3O3S — CID 46436028
ethyl 5-ethyl-2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]thiophene-3-carboxylate (PubChem CID 46436028) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 5-ethyl-2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-ethyl-2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 46436028 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl 5-ethyl-2-[[1-(4-fluorophenyl)pyrazole-3-carbonyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)c1ccn(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H18FN3O3S/c1-3-14-11-15(19(25)26-4-2)18(27-14)21-17(24)16-9-10-23(22-16)13-7-5-12(20)6-8-13/h5-11H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | CWLLHNYWEYDYMC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |