C24H28N6O4 — CID 46439359
[2-(dimethylamino)-5-nitrophenyl]-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]methanone (PubChem CID 46439359) has the molecular formula C24H28N6O4 and a molecular weight of 464.53 g/mol. Its IUPAC name is [2-(dimethylamino)-5-nitrophenyl]-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]methanone.
| Compound Name | [2-(dimethylamino)-5-nitrophenyl]-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46439359 |
| Molecular Formula | C24H28N6O4 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | [2-(dimethylamino)-5-nitrophenyl]-[4-[1-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]ethyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(-c2noc(C(C)N3CCN(C(=O)c4cc([N+](=O)[O-])ccc4N(C)C)CC3)n2)cc1 |
| InChI | InChI=1S/C24H28N6O4/c1-16-5-7-18(8-6-16)22-25-23(34-26-22)17(2)28-11-13-29(14-12-28)24(31)20-15-19(30(32)33)9-10-21(20)27(3)4/h5-10,15,17H,11-14H2,1-4H3 |
| InChIKey | MRTWKIYNDGRHDP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|