C21H29N3O4 — CID 46443258
tert-butyl N-[4-[4-(cyclopropanecarbonylamino)piperidine-1-carbonyl]phenyl]carbamate (PubChem CID 46443258) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is tert-butyl N-[4-[4-(cyclopropanecarbonylamino)piperidine-1-carbonyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-(cyclopropanecarbonylamino)piperidine-1-carbonyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46443258 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | tert-butyl N-[4-[4-(cyclopropanecarbonylamino)piperidine-1-carbonyl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(=O)N2CCC(NC(=O)C3CC3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-21(2,3)28-20(27)23-16-8-6-15(7-9-16)19(26)24-12-10-17(11-13-24)22-18(25)14-4-5-14/h6-9,14,17H,4-5,10-13H2,1-3H3,(H,22,25)(H,23,27) |
| InChIKey | LWZBOFXYTKSFRB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |