C14H13F2NO2 — CID 46443441
3,5-difluoro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide (PubChem CID 46443441) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is 3,5-difluoro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide.
| Compound Name | 3,5-difluoro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 46443441 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 3,5-difluoro-N-[1-(5-methylfuran-2-yl)ethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2cc(F)cc(F)c2)o1 |
| InChI | InChI=1S/C14H13F2NO2/c1-8-3-4-13(19-8)9(2)17-14(18)10-5-11(15)7-12(16)6-10/h3-7,9H,1-2H3,(H,17,18) |
| InChIKey | FORNHPLNNWXPKT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |