C16H17FN2O3 — CID 78836869
3-fluoro-N-[2-[1-(5-methylfuran-2-yl)ethylamino]-2-oxoethyl]benzamide (PubChem CID 78836869) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 3-fluoro-N-[2-[1-(5-methylfuran-2-yl)ethylamino]-2-oxoethyl]benzamide.
| Compound Name | 3-fluoro-N-[2-[1-(5-methylfuran-2-yl)ethylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 78836869 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-fluoro-N-[2-[1-(5-methylfuran-2-yl)ethylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(C(C)NC(=O)CNC(=O)c2cccc(F)c2)o1 |
| InChI | InChI=1S/C16H17FN2O3/c1-10-6-7-14(22-10)11(2)19-15(20)9-18-16(21)12-4-3-5-13(17)8-12/h3-8,11H,9H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | VPEYWMMHJRFJPP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |