C28H27N3O3 — CID 46448346
N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzamide (PubChem CID 46448346) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzamide.
| Compound Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
|---|---|
| PubChem CID | 46448346 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-methyl-N-[(4-morpholin-4-ylphenyl)methyl]-2-(5-phenyl-1,3-oxazol-2-yl)benzamide |
| SMILES | CN(Cc1ccc(N2CCOCC2)cc1)C(=O)c1ccccc1-c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C28H27N3O3/c1-30(20-21-11-13-23(14-12-21)31-15-17-33-18-16-31)28(32)25-10-6-5-9-24(25)27-29-19-26(34-27)22-7-3-2-4-8-22/h2-14,19H,15-18,20H2,1H3 |
| InChIKey | IZZHSVDTNWUOKS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|