C15H23N3O5S — CID 46450279
ethyl N-[3-[3-[methyl(methylsulfonyl)amino]propylcarbamoyl]phenyl]carbamate (PubChem CID 46450279) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is ethyl N-[3-[3-[methyl(methylsulfonyl)amino]propylcarbamoyl]phenyl]carbamate.
| Compound Name | ethyl N-[3-[3-[methyl(methylsulfonyl)amino]propylcarbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 46450279 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | ethyl N-[3-[3-[methyl(methylsulfonyl)amino]propylcarbamoyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(C(=O)NCCCN(C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H23N3O5S/c1-4-23-15(20)17-13-8-5-7-12(11-13)14(19)16-9-6-10-18(2)24(3,21)22/h5,7-8,11H,4,6,9-10H2,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | LUZVFYGDVBOUTP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|