C18H19IN2O3S — CID 46450480
(E)-3-[4-(ethylsulfamoyl)phenyl]-N-(4-iodo-2-methylphenyl)prop-2-enamide (PubChem CID 46450480) has the molecular formula C18H19IN2O3S and a molecular weight of 470.33 g/mol. Its IUPAC name is (E)-3-[4-(ethylsulfamoyl)phenyl]-N-(4-iodo-2-methylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46450480 |
| Molecular Formula | C18H19IN2O3S |
| Molecular Weight | 470.33 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-(4-iodo-2-methylphenyl)prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)Nc2ccc(I)cc2C)cc1 |
| InChI | InChI=1S/C18H19IN2O3S/c1-3-20-25(23,24)16-8-4-14(5-9-16)6-11-18(22)21-17-10-7-15(19)12-13(17)2/h4-12,20H,3H2,1-2H3,(H,21,22)/b11-6+ |
| InChIKey | DVCSMQHUVHAOFG-IZZDOVSWSA-N |
| XLogP | 3.55 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|