C17H22N2OS2 — CID 46453331
4-methyl-N-(3-phenylsulfanylpropyl)-2-propan-2-yl-1,3-thiazole-5-carboxamide (PubChem CID 46453331) has the molecular formula C17H22N2OS2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 4-methyl-N-(3-phenylsulfanylpropyl)-2-propan-2-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-(3-phenylsulfanylpropyl)-2-propan-2-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46453331 |
| Molecular Formula | C17H22N2OS2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 4-methyl-N-(3-phenylsulfanylpropyl)-2-propan-2-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C(C)C)sc1C(=O)NCCCSc1ccccc1 |
| InChI | InChI=1S/C17H22N2OS2/c1-12(2)17-19-13(3)15(22-17)16(20)18-10-7-11-21-14-8-5-4-6-9-14/h4-6,8-9,12H,7,10-11H2,1-3H3,(H,18,20) |
| InChIKey | FHTBAFHMUXRZAZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|