C26H29ClN4O2 — CID 46455345
N-[1-(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)piperidin-4-yl]-3-phenylpropanamide (PubChem CID 46455345) has the molecular formula C26H29ClN4O2 and a molecular weight of 465.00 g/mol. Its IUPAC name is N-[1-(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)piperidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[1-(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)piperidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 46455345 |
| Molecular Formula | C26H29ClN4O2 |
| Molecular Weight | 465.00 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | N-[1-(1-benzyl-5-chloro-3-methylpyrazole-4-carbonyl)piperidin-4-yl]-3-phenylpropanamide |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)N1CCC(NC(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29ClN4O2/c1-19-24(25(27)31(29-19)18-21-10-6-3-7-11-21)26(33)30-16-14-22(15-17-30)28-23(32)13-12-20-8-4-2-5-9-20/h2-11,22H,12-18H2,1H3,(H,28,32) |
| InChIKey | VHPJLBNLGLEEAE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.00 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |