C17H20ClN3O2 — CID 95139427
(1-benzyl-5-chloro-3-methylpyrazol-4-yl)-[(2S)-2-methylmorpholin-4-yl]methanone (PubChem CID 95139427) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is (1-benzyl-5-chloro-3-methylpyrazol-4-yl)-[(2S)-2-methylmorpholin-4-yl]methanone.
| Compound Name | (1-benzyl-5-chloro-3-methylpyrazol-4-yl)-[(2S)-2-methylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 95139427 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (1-benzyl-5-chloro-3-methylpyrazol-4-yl)-[(2S)-2-methylmorpholin-4-yl]methanone |
| SMILES | Cc1nn(Cc2ccccc2)c(Cl)c1C(=O)N1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-12-10-20(8-9-23-12)17(22)15-13(2)19-21(16(15)18)11-14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | LWIZCQOQHSUJCV-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |