C24H28N2O — CID 46455853
N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-2-naphthalen-2-ylacetamide (PubChem CID 46455853) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-2-naphthalen-2-ylacetamide.
| Compound Name | N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 46455853 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]-2-naphthalen-2-ylacetamide |
| SMILES | CC(C)N(C)Cc1ccccc1CNC(=O)Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H28N2O/c1-18(2)26(3)17-23-11-7-6-10-22(23)16-25-24(27)15-19-12-13-20-8-4-5-9-21(20)14-19/h4-14,18H,15-17H2,1-3H3,(H,25,27) |
| InChIKey | BMSMNIOQPOFDEB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |