C25H29N3O4 — CID 46463459
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]propanamide (PubChem CID 46463459) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 46463459 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]propanamide |
| SMILES | CC(NC(=O)CCN1C(=O)C2CCCCC2C1=O)c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H29N3O4/c1-17(19-8-10-20(11-9-19)32-16-18-5-4-13-26-15-18)27-23(29)12-14-28-24(30)21-6-2-3-7-22(21)25(28)31/h4-5,8-11,13,15,17,21-22H,2-3,6-7,12,14,16H2,1H3,(H,27,29) |
| InChIKey | PMJANIIBVCCCLS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|