C18H20N4O — CID 46463836
N-[[2-(dimethylamino)-3-pyridinyl]methyl]-2-(1H-indol-3-yl)acetamide (PubChem CID 46463836) has the molecular formula C18H20N4O and a molecular weight of 308.39 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-pyridinyl]methyl]-2-(1H-indol-3-yl)acetamide.
| Compound Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-2-(1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 46463836 |
| Molecular Formula | C18H20N4O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-2-(1H-indol-3-yl)acetamide |
| SMILES | CN(C)c1ncccc1CNC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20N4O/c1-22(2)18-13(6-5-9-19-18)11-21-17(23)10-14-12-20-16-8-4-3-7-15(14)16/h3-9,12,20H,10-11H2,1-2H3,(H,21,23) |
| InChIKey | DTYPVDZWYYTTAV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |