C16H17N5O — CID 42594608
N-[[2-(dimethylamino)-3-pyridinyl]methyl]-1H-indazole-3-carboxamide (PubChem CID 42594608) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-[[2-(dimethylamino)-3-pyridinyl]methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 42594608 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[[2-(dimethylamino)-3-pyridinyl]methyl]-1H-indazole-3-carboxamide |
| SMILES | CN(C)c1ncccc1CNC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C16H17N5O/c1-21(2)15-11(6-5-9-17-15)10-18-16(22)14-12-7-3-4-8-13(12)19-20-14/h3-9H,10H2,1-2H3,(H,18,22)(H,19,20) |
| InChIKey | ATVWTAPSQQGOJG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |