C14H15N5O — CID 115991487
N-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-indazole-3-carboxamide (PubChem CID 115991487) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 115991487 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-1H-indazole-3-carboxamide |
| SMILES | Cc1nn(C)cc1CNC(=O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H15N5O/c1-9-10(8-19(2)18-9)7-15-14(20)13-11-5-3-4-6-12(11)16-17-13/h3-6,8H,7H2,1-2H3,(H,15,20)(H,16,17) |
| InChIKey | LFJPHLDFYNVIJO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |