C20H21N5O4 — CID 46467941
4-(cyclopropylamino)-3-nitro-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide (PubChem CID 46467941) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 46467941 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-[4-(3-oxopiperazin-1-yl)phenyl]benzamide |
| SMILES | O=C1CN(c2ccc(NC(=O)c3ccc(NC4CC4)c([N+](=O)[O-])c3)cc2)CCN1 |
| InChI | InChI=1S/C20H21N5O4/c26-19-12-24(10-9-21-19)16-6-4-15(5-7-16)23-20(27)13-1-8-17(22-14-2-3-14)18(11-13)25(28)29/h1,4-8,11,14,22H,2-3,9-10,12H2,(H,21,26)(H,23,27) |
| InChIKey | KNEFZCRSAPTMKG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|