C19H20N4OS — CID 46476246
N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 46476246) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46476246 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(CCNC(=O)c3ccc[nH]c3=S)cc2)n1 |
| InChI | InChI=1S/C19H20N4OS/c1-13-12-14(2)23(22-13)16-7-5-15(6-8-16)9-11-20-18(24)17-4-3-10-21-19(17)25/h3-8,10,12H,9,11H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | LDLGDFHXQWVBAJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|