C24H30N4O4S — CID 55707293
N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide (PubChem CID 55707293) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 55707293 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-5-(2-methoxyethylsulfamoyl)-2-methylbenzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C)c(C(=O)NCCc2ccc(-n3nc(C)cc3C)cc2)c1 |
| InChI | InChI=1S/C24H30N4O4S/c1-17-5-10-22(33(30,31)26-13-14-32-4)16-23(17)24(29)25-12-11-20-6-8-21(9-7-20)28-19(3)15-18(2)27-28/h5-10,15-16,26H,11-14H2,1-4H3,(H,25,29) |
| InChIKey | PEUPLMURCDXWRD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|