C15H14BrFN2O3S — CID 46476520
3-bromo-5-fluoro-N-[[2-(methanesulfonamido)phenyl]methyl]benzamide (PubChem CID 46476520) has the molecular formula C15H14BrFN2O3S and a molecular weight of 401.26 g/mol. Its IUPAC name is 3-bromo-5-fluoro-N-[[2-(methanesulfonamido)phenyl]methyl]benzamide.
| Compound Name | 3-bromo-5-fluoro-N-[[2-(methanesulfonamido)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46476520 |
| Molecular Formula | C15H14BrFN2O3S |
| Molecular Weight | 401.26 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 3-bromo-5-fluoro-N-[[2-(methanesulfonamido)phenyl]methyl]benzamide |
| SMILES | CS(=O)(=O)Nc1ccccc1CNC(=O)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C15H14BrFN2O3S/c1-23(21,22)19-14-5-3-2-4-10(14)9-18-15(20)11-6-12(16)8-13(17)7-11/h2-8,19H,9H2,1H3,(H,18,20) |
| InChIKey | FGQVKNWEFIKFJW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.26 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |