C24H24N4O3 — CID 46476578
N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 46476578) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 46476578 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-[2-[4-(3,5-dimethylpyrazol-1-yl)phenyl]ethyl]-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | Cc1cc(C)n(-c2ccc(CCNC(=O)CCN3C(=O)c4ccccc4C3=O)cc2)n1 |
| InChI | InChI=1S/C24H24N4O3/c1-16-15-17(2)28(26-16)19-9-7-18(8-10-19)11-13-25-22(29)12-14-27-23(30)20-5-3-4-6-21(20)24(27)31/h3-10,15H,11-14H2,1-2H3,(H,25,29) |
| InChIKey | IAYMIGFIGQIVTK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|