C18H27N3O5S — CID 46479984
3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 46479984) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 46479984 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)sulfonylpiperazin-1-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(CCC(=O)N3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C18H27N3O5S/c1-25-16-2-4-17(5-3-16)27(23,24)21-10-8-19(9-11-21)7-6-18(22)20-12-14-26-15-13-20/h2-5H,6-15H2,1H3 |
| InChIKey | PDBWXNBXCYGVDW-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |