C25H27N3O5S — CID 46480295
1-(benzenesulfonyl)-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]piperidine-3-carboxamide (PubChem CID 46480295) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 46480295 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 1-(benzenesulfonyl)-N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(NC(=O)C2CCCN(S(=O)(=O)c3ccccc3)C2)cc1OCc1cccnc1 |
| InChI | InChI=1S/C25H27N3O5S/c1-32-23-12-11-21(15-24(23)33-18-19-7-5-13-26-16-19)27-25(29)20-8-6-14-28(17-20)34(30,31)22-9-3-2-4-10-22/h2-5,7,9-13,15-16,20H,6,8,14,17-18H2,1H3,(H,27,29) |
| InChIKey | CLCDJJLOAXEUTJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |