C24H25N3O6S — CID 43069830
N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 43069830) has the molecular formula C24H25N3O6S and a molecular weight of 483.55 g/mol. Its IUPAC name is N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 43069830 |
| Molecular Formula | C24H25N3O6S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[4-methoxy-3-(pyridin-3-ylmethoxy)phenyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | COc1ccc(NC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)cc1OCc1cccnc1 |
| InChI | InChI=1S/C24H25N3O6S/c1-31-22-8-7-20(15-23(22)33-17-18-4-3-9-25-16-18)26-24(28)19-5-2-6-21(14-19)34(29,30)27-10-12-32-13-11-27/h2-9,14-16H,10-13,17H2,1H3,(H,26,28) |
| InChIKey | VAAWQCREQAHUJN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |