C16H14F3N3O4 — CID 46481099
N-methyl-N-[(3-nitrophenyl)methyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 46481099) has the molecular formula C16H14F3N3O4 and a molecular weight of 369.30 g/mol. Its IUPAC name is N-methyl-N-[(3-nitrophenyl)methyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-methyl-N-[(3-nitrophenyl)methyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 46481099 |
| Molecular Formula | C16H14F3N3O4 |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-methyl-N-[(3-nitrophenyl)methyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | CN(Cc1cccc([N+](=O)[O-])c1)C(=O)c1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C16H14F3N3O4/c1-21(9-11-3-2-4-13(7-11)22(24)25)15(23)12-5-6-14(20-8-12)26-10-16(17,18)19/h2-8H,9-10H2,1H3 |
| InChIKey | XRWPMEHINOKDDH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|