C17H15ClF3N3O4 — CID 55740102
5-chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 55740102) has the molecular formula C17H15ClF3N3O4 and a molecular weight of 417.77 g/mol. Its IUPAC name is 5-chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | 5-chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55740102 |
| Molecular Formula | C17H15ClF3N3O4 |
| Molecular Weight | 417.77 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 5-chloro-N-methyl-N-[1-(3-nitrophenyl)ethyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | CC(c1cccc([N+](=O)[O-])c1)N(C)C(=O)c1cnc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C17H15ClF3N3O4/c1-10(11-4-3-5-13(6-11)24(26)27)23(2)16(25)12-7-14(18)15(22-8-12)28-9-17(19,20)21/h3-8,10H,9H2,1-2H3 |
| InChIKey | NCWQHWRKAXFPCB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.77 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|