C17H25NO5 — CID 46481594
methyl 6-[2-(4-methoxyphenoxy)propanoylamino]hexanoate (PubChem CID 46481594) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is methyl 6-[2-(4-methoxyphenoxy)propanoylamino]hexanoate.
| Compound Name | methyl 6-[2-(4-methoxyphenoxy)propanoylamino]hexanoate |
|---|---|
| PubChem CID | 46481594 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | methyl 6-[2-(4-methoxyphenoxy)propanoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)C(C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C17H25NO5/c1-13(23-15-10-8-14(21-2)9-11-15)17(20)18-12-6-4-5-7-16(19)22-3/h8-11,13H,4-7,12H2,1-3H3,(H,18,20) |
| InChIKey | XNBPIVBXWKIVKB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|