C24H26N4O3 — CID 46481869
(E)-3-(1-benzyltriazol-4-yl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide (PubChem CID 46481869) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is (E)-3-(1-benzyltriazol-4-yl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(1-benzyltriazol-4-yl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 46481869 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (E)-3-(1-benzyltriazol-4-yl)-N-[[4-(oxolan-2-ylmethoxy)phenyl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cn(Cc2ccccc2)nn1)NCc1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c29-24(13-10-21-17-28(27-26-21)16-20-5-2-1-3-6-20)25-15-19-8-11-22(12-9-19)31-18-23-7-4-14-30-23/h1-3,5-6,8-13,17,23H,4,7,14-16,18H2,(H,25,29)/b13-10+ |
| InChIKey | LWMWSUOISYUOGQ-JLHYYAGUSA-N |
| XLogP | 3.21 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|